Synthesis and crystal structure of 4-(3,4,5-Trimethoxyphenyl)-N3,N5-BIS(3-Chloro-4-Fluoro-Phenyl)-2,6-Dimethyl-Pyridine

The title compound, C30H29Cl2F2N3O7, crystallizes in the triclinic crystal system and space group P-1 with cell parameters a = 7.0250(18) A, b = 14.311(5) A, c = 15.841(6) A, α = 107.437(7)°, β = 91.69(2)°, γ = 100.36(2)°, V = 1488.7(9) A3 for Z = 2. The structure exhibits inter-molecular hydrogen bonds of the type N-H…O.